C13H21NO — CID 12570840
1-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)pyrrolidine (PubChem CID 12570840) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)pyrrolidine.
| Compound Name | 1-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 12570840 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 1-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)pyrrolidine |
| SMILES | CC1(C)C=C(N2CCCC2)C2OC2(C)C1 |
| InChI | InChI=1S/C13H21NO/c1-12(2)8-10(14-6-4-5-7-14)11-13(3,9-12)15-11/h8,11H,4-7,9H2,1-3H3 |
| InChIKey | IXUPRKAZBPEEKR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|