C16H23NO — CID 12572160
(1E)-N,N-diethyl-4-methyl-1-phenoxypenta-1,3-dien-1-amine (PubChem CID 12572160) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (1E)-N,N-diethyl-4-methyl-1-phenoxypenta-1,3-dien-1-amine.
| Compound Name | (1E)-N,N-diethyl-4-methyl-1-phenoxypenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 12572160 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (1E)-N,N-diethyl-4-methyl-1-phenoxypenta-1,3-dien-1-amine |
| SMILES | CCN(CC)/C(=C\C=C(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C16H23NO/c1-5-17(6-2)16(13-12-14(3)4)18-15-10-8-7-9-11-15/h7-13H,5-6H2,1-4H3/b16-13+ |
| InChIKey | KNIZXRLZWHDSDM-DTQAZKPQSA-N |
| XLogP | 4.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|