C14H26ClO3P — CID 12574699
3-chloro-2-dibutoxyphosphoryl-4-methylpenta-1,3-diene (PubChem CID 12574699) has the molecular formula C14H26ClO3P and a molecular weight of 308.79 g/mol. Its IUPAC name is 3-chloro-2-dibutoxyphosphoryl-4-methylpenta-1,3-diene.
| Compound Name | 3-chloro-2-dibutoxyphosphoryl-4-methylpenta-1,3-diene |
|---|---|
| PubChem CID | 12574699 |
| Molecular Formula | C14H26ClO3P |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 3-chloro-2-dibutoxyphosphoryl-4-methylpenta-1,3-diene |
| SMILES | C=C(C(Cl)=C(C)C)P(=O)(OCCCC)OCCCC |
| InChI | InChI=1S/C14H26ClO3P/c1-6-8-10-17-19(16,18-11-9-7-2)13(5)14(15)12(3)4/h5-11H2,1-4H3 |
| InChIKey | UHJGTUQHYBJMBH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|