C11H20ClO3P — CID 12644832
(1Z)-2-chloro-1-diethoxyphosphoryl-3,4-dimethylpenta-1,3-diene (PubChem CID 12644832) has the molecular formula C11H20ClO3P and a molecular weight of 266.70 g/mol. Its IUPAC name is (1Z)-2-chloro-1-diethoxyphosphoryl-3,4-dimethylpenta-1,3-diene.
| Compound Name | (1Z)-2-chloro-1-diethoxyphosphoryl-3,4-dimethylpenta-1,3-diene |
|---|---|
| PubChem CID | 12644832 |
| Molecular Formula | C11H20ClO3P |
| Molecular Weight | 266.70 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | (1Z)-2-chloro-1-diethoxyphosphoryl-3,4-dimethylpenta-1,3-diene |
| SMILES | CCOP(=O)(/C=C(\Cl)C(C)=C(C)C)OCC |
| InChI | InChI=1S/C11H20ClO3P/c1-6-14-16(13,15-7-2)8-11(12)10(5)9(3)4/h8H,6-7H2,1-5H3/b11-8- |
| InChIKey | LUOHGUDUVCFMEY-FLIBITNWSA-N |
| XLogP | 4.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.70 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|