C8H14ClO3P — CID 171377941
(1Z,3E)-2-chloro-1-dimethoxyphosphoryl-3-methylpenta-1,3-diene (PubChem CID 171377941) has the molecular formula C8H14ClO3P and a molecular weight of 224.62 g/mol. Its IUPAC name is (1Z,3E)-2-chloro-1-dimethoxyphosphoryl-3-methylpenta-1,3-diene.
| Compound Name | (1Z,3E)-2-chloro-1-dimethoxyphosphoryl-3-methylpenta-1,3-diene |
|---|---|
| PubChem CID | 171377941 |
| Molecular Formula | C8H14ClO3P |
| Molecular Weight | 224.62 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | (1Z,3E)-2-chloro-1-dimethoxyphosphoryl-3-methylpenta-1,3-diene |
| SMILES | C/C=C(C)/C(Cl)=C/P(=O)(OC)OC |
| InChI | InChI=1S/C8H14ClO3P/c1-5-7(2)8(9)6-13(10,11-3)12-4/h5-6H,1-4H3/b7-5+,8-6- |
| InChIKey | JISCYJOWXTYTLD-YMBWGVAGSA-N |
| XLogP | 3.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.62 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|