C9H16ClO3P — CID 12644829
(1Z,3E)-2-chloro-1-dimethoxyphosphoryl-3-ethylpenta-1,3-diene (PubChem CID 12644829) has the molecular formula C9H16ClO3P and a molecular weight of 238.65 g/mol. Its IUPAC name is (1Z,3E)-2-chloro-1-dimethoxyphosphoryl-3-ethylpenta-1,3-diene.
| Compound Name | (1Z,3E)-2-chloro-1-dimethoxyphosphoryl-3-ethylpenta-1,3-diene |
|---|---|
| PubChem CID | 12644829 |
| Molecular Formula | C9H16ClO3P |
| Molecular Weight | 238.65 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | (1Z,3E)-2-chloro-1-dimethoxyphosphoryl-3-ethylpenta-1,3-diene |
| SMILES | C/C=C(CC)/C(Cl)=C/P(=O)(OC)OC |
| InChI | InChI=1S/C9H16ClO3P/c1-5-8(6-2)9(10)7-14(11,12-3)13-4/h5,7H,6H2,1-4H3/b8-5+,9-7- |
| InChIKey | WZMAQCDFMOPDRF-KCGQVOQMSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.65 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|