C13H24ClO3P — CID 12644835
(E)-4-[(Z)-1-chloro-2-diethoxyphosphorylethenyl]hept-3-ene (PubChem CID 12644835) has the molecular formula C13H24ClO3P and a molecular weight of 294.76 g/mol. Its IUPAC name is (E)-4-[(Z)-1-chloro-2-diethoxyphosphorylethenyl]hept-3-ene.
| Compound Name | (E)-4-[(Z)-1-chloro-2-diethoxyphosphorylethenyl]hept-3-ene |
|---|---|
| PubChem CID | 12644835 |
| Molecular Formula | C13H24ClO3P |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (E)-4-[(Z)-1-chloro-2-diethoxyphosphorylethenyl]hept-3-ene |
| SMILES | CC/C=C(CCC)/C(Cl)=C/P(=O)(OCC)OCC |
| InChI | InChI=1S/C13H24ClO3P/c1-5-9-12(10-6-2)13(14)11-18(15,16-7-3)17-8-4/h9,11H,5-8,10H2,1-4H3/b12-9+,13-11- |
| InChIKey | DNZKMRQGPNQHBI-NYGJOUKGSA-N |
| XLogP | 5.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|