C11H17ClF3O3P — CID 102396372
(Z,4Z)-1-chloro-4-(diethoxyphosphorylmethylidene)-1,1,2-trifluorohex-2-ene (PubChem CID 102396372) has the molecular formula C11H17ClF3O3P and a molecular weight of 320.68 g/mol. Its IUPAC name is (Z,4Z)-1-chloro-4-(diethoxyphosphorylmethylidene)-1,1,2-trifluorohex-2-ene.
| Compound Name | (Z,4Z)-1-chloro-4-(diethoxyphosphorylmethylidene)-1,1,2-trifluorohex-2-ene |
|---|---|
| PubChem CID | 102396372 |
| Molecular Formula | C11H17ClF3O3P |
| Molecular Weight | 320.68 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (Z,4Z)-1-chloro-4-(diethoxyphosphorylmethylidene)-1,1,2-trifluorohex-2-ene |
| SMILES | CCOP(=O)(/C=C(\C=C(/F)C(F)(F)Cl)CC)OCC |
| InChI | InChI=1S/C11H17ClF3O3P/c1-4-9(7-10(13)11(12,14)15)8-19(16,17-5-2)18-6-3/h7-8H,4-6H2,1-3H3/b9-8-,10-7- |
| InChIKey | DDIGZRHDJCTZFY-NFIXMJHSSA-N |
| XLogP | 5.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.68 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|