C10H19F2O3P — CID 14268061
5-diethoxyphosphoryl-5,5-difluoro-2-methylpent-2-ene (PubChem CID 14268061) has the molecular formula C10H19F2O3P and a molecular weight of 256.23 g/mol. Its IUPAC name is 5-diethoxyphosphoryl-5,5-difluoro-2-methylpent-2-ene.
| Compound Name | 5-diethoxyphosphoryl-5,5-difluoro-2-methylpent-2-ene |
|---|---|
| PubChem CID | 14268061 |
| Molecular Formula | C10H19F2O3P |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 5-diethoxyphosphoryl-5,5-difluoro-2-methylpent-2-ene |
| SMILES | CCOP(=O)(OCC)C(F)(F)CC=C(C)C |
| InChI | InChI=1S/C10H19F2O3P/c1-5-14-16(13,15-6-2)10(11,12)8-7-9(3)4/h7H,5-6,8H2,1-4H3 |
| InChIKey | ACQOYUWYBZOAOC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|