C15H27O3P — CID 11266150
(1E,3E)-1-diethoxyphosphoryl-4,8-dimethylnona-1,3,7-triene (PubChem CID 11266150) has the molecular formula C15H27O3P and a molecular weight of 286.35 g/mol. Its IUPAC name is (1E,3E)-1-diethoxyphosphoryl-4,8-dimethylnona-1,3,7-triene.
| Compound Name | (1E,3E)-1-diethoxyphosphoryl-4,8-dimethylnona-1,3,7-triene |
|---|---|
| PubChem CID | 11266150 |
| Molecular Formula | C15H27O3P |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (1E,3E)-1-diethoxyphosphoryl-4,8-dimethylnona-1,3,7-triene |
| SMILES | CCOP(=O)(/C=C/C=C(\C)CCC=C(C)C)OCC |
| InChI | InChI=1S/C15H27O3P/c1-6-17-19(16,18-7-2)13-9-12-15(5)11-8-10-14(3)4/h9-10,12-13H,6-8,11H2,1-5H3/b13-9+,15-12+ |
| InChIKey | CGALDTJFFJGXSW-OGGMOHOESA-N |
| XLogP | 5.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|