C20H37O3P — CID 134870879
(6E,10E)-13-diethoxyphosphoryl-2,6,10-trimethyltrideca-2,6,10-triene (PubChem CID 134870879) has the molecular formula C20H37O3P and a molecular weight of 356.49 g/mol. Its IUPAC name is (6E,10E)-13-diethoxyphosphoryl-2,6,10-trimethyltrideca-2,6,10-triene.
| Compound Name | (6E,10E)-13-diethoxyphosphoryl-2,6,10-trimethyltrideca-2,6,10-triene |
|---|---|
| PubChem CID | 134870879 |
| Molecular Formula | C20H37O3P |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | (6E,10E)-13-diethoxyphosphoryl-2,6,10-trimethyltrideca-2,6,10-triene |
| SMILES | CCOP(=O)(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)OCC |
| InChI | InChI=1S/C20H37O3P/c1-7-22-24(21,23-8-2)17-11-16-20(6)15-10-14-19(5)13-9-12-18(3)4/h12,14,16H,7-11,13,15,17H2,1-6H3/b19-14+,20-16+ |
| InChIKey | VVWOBIIWKXPIER-XHGFWWIISA-N |
| XLogP | 7.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|