C15H29O3P — CID 10589442
(4Z)-4-diethoxyphosphoryl-5-ethylnona-1,4-diene (PubChem CID 10589442) has the molecular formula C15H29O3P and a molecular weight of 288.37 g/mol. Its IUPAC name is (4Z)-4-diethoxyphosphoryl-5-ethylnona-1,4-diene.
| Compound Name | (4Z)-4-diethoxyphosphoryl-5-ethylnona-1,4-diene |
|---|---|
| PubChem CID | 10589442 |
| Molecular Formula | C15H29O3P |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | (4Z)-4-diethoxyphosphoryl-5-ethylnona-1,4-diene |
| SMILES | C=CC/C(=C(\CC)CCCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C15H29O3P/c1-6-11-13-14(8-3)15(12-7-2)19(16,17-9-4)18-10-5/h7H,2,6,8-13H2,1,3-5H3/b15-14- |
| InChIKey | KKUHHJXMQNMWSU-PFONDFGASA-N |
| XLogP | 5.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|