C17H31O3P — CID 85101259
1-dimethoxyphosphoryl-3,7,11-trimethyldodeca-2,6,10-triene (PubChem CID 85101259) has the molecular formula C17H31O3P and a molecular weight of 314.41 g/mol. Its IUPAC name is 1-dimethoxyphosphoryl-3,7,11-trimethyldodeca-2,6,10-triene.
| Compound Name | 1-dimethoxyphosphoryl-3,7,11-trimethyldodeca-2,6,10-triene |
|---|---|
| PubChem CID | 85101259 |
| Molecular Formula | C17H31O3P |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1-dimethoxyphosphoryl-3,7,11-trimethyldodeca-2,6,10-triene |
| SMILES | COP(=O)(CC=C(C)CCC=C(C)CCC=C(C)C)OC |
| InChI | InChI=1S/C17H31O3P/c1-15(2)9-7-10-16(3)11-8-12-17(4)13-14-21(18,19-5)20-6/h9,11,13H,7-8,10,12,14H2,1-6H3 |
| InChIKey | PWJYFWGHJGZRHH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|