C15H27O3P — CID 87674765
3,7,11-trimethyldodeca-2,6,10-trienylphosphonic acid (PubChem CID 87674765) has the molecular formula C15H27O3P and a molecular weight of 286.35 g/mol. Its IUPAC name is 3,7,11-trimethyldodeca-2,6,10-trienylphosphonic acid.
| Compound Name | 3,7,11-trimethyldodeca-2,6,10-trienylphosphonic acid |
|---|---|
| PubChem CID | 87674765 |
| Molecular Formula | C15H27O3P |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 3,7,11-trimethyldodeca-2,6,10-trienylphosphonic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCP(=O)(O)O |
| InChI | InChI=1S/C15H27O3P/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-19(16,17)18/h7,9,11H,5-6,8,10,12H2,1-4H3,(H2,16,17,18) |
| InChIKey | DSVZUYVWXFXSKG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|