C13H26O6P2 — CID 10382597
[(5E)-6,10-dimethyl-1-phosphonoundeca-5,9-dienyl]phosphonic acid (PubChem CID 10382597) has the molecular formula C13H26O6P2 and a molecular weight of 340.29 g/mol. Its IUPAC name is [(5E)-6,10-dimethyl-1-phosphonoundeca-5,9-dienyl]phosphonic acid.
| Compound Name | [(5E)-6,10-dimethyl-1-phosphonoundeca-5,9-dienyl]phosphonic acid |
|---|---|
| PubChem CID | 10382597 |
| Molecular Formula | C13H26O6P2 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | [(5E)-6,10-dimethyl-1-phosphonoundeca-5,9-dienyl]phosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CCCC(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C13H26O6P2/c1-11(2)7-6-9-12(3)8-4-5-10-13(20(14,15)16)21(17,18)19/h7-8,13H,4-6,9-10H2,1-3H3,(H2,14,15,16)(H2,17,18,19)/b12-8+ |
| InChIKey | ISMDHWZGHKZNRH-XYOKQWHBSA-N |
| XLogP | 3.53 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|