C20H38O6P2 — CID 10003142
[(5E,9E)-1-[hydroxy(methoxymethyl)phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-trienyl]phosphonic acid (PubChem CID 10003142) has the molecular formula C20H38O6P2 and a molecular weight of 436.47 g/mol. Its IUPAC name is [(5E,9E)-1-[hydroxy(methoxymethyl)phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-trienyl]phosphonic acid.
| Compound Name | [(5E,9E)-1-[hydroxy(methoxymethyl)phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-trienyl]phosphonic acid |
|---|---|
| PubChem CID | 10003142 |
| Molecular Formula | C20H38O6P2 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | [(5E,9E)-1-[hydroxy(methoxymethyl)phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-trienyl]phosphonic acid |
| SMILES | COCP(=O)(O)C(CCC/C=C(\C)CC/C=C(\C)CCC=C(C)C)P(=O)(O)O |
| InChI | InChI=1S/C20H38O6P2/c1-17(2)10-8-12-19(4)14-9-13-18(3)11-6-7-15-20(28(23,24)25)27(21,22)16-26-5/h10-11,14,20H,6-9,12-13,15-16H2,1-5H3,(H,21,22)(H2,23,24,25)/b18-11+,19-14+ |
| InChIKey | PLYWNJNFYQHMNE-MMOYSQFZSA-N |
| XLogP | 5.95 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|