C20H38O5P2 — CID 10319958
[(6E,10E)-1-[hydroxy(methyl)phosphoryl]-7,11,15-trimethylhexadeca-6,10,14-trienyl]phosphonic acid (PubChem CID 10319958) has the molecular formula C20H38O5P2 and a molecular weight of 420.47 g/mol. Its IUPAC name is [(6E,10E)-1-[hydroxy(methyl)phosphoryl]-7,11,15-trimethylhexadeca-6,10,14-trienyl]phosphonic acid.
| Compound Name | [(6E,10E)-1-[hydroxy(methyl)phosphoryl]-7,11,15-trimethylhexadeca-6,10,14-trienyl]phosphonic acid |
|---|---|
| PubChem CID | 10319958 |
| Molecular Formula | C20H38O5P2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | [(6E,10E)-1-[hydroxy(methyl)phosphoryl]-7,11,15-trimethylhexadeca-6,10,14-trienyl]phosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCCCC(P(C)(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C20H38O5P2/c1-17(2)11-9-13-19(4)15-10-14-18(3)12-7-6-8-16-20(26(5,21)22)27(23,24)25/h11-12,15,20H,6-10,13-14,16H2,1-5H3,(H,21,22)(H2,23,24,25)/b18-12+,19-15+ |
| InChIKey | HLSKAJYMVHWBBB-XYAZGONESA-N |
| XLogP | 6.37 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|