C18H36O5P2 — CID 10000711
[(9E)-1-[hydroxy(methyl)phosphoryl]-10,14-dimethylpentadeca-9,13-dienyl]phosphonic acid (PubChem CID 10000711) has the molecular formula C18H36O5P2 and a molecular weight of 394.43 g/mol. Its IUPAC name is [(9E)-1-[hydroxy(methyl)phosphoryl]-10,14-dimethylpentadeca-9,13-dienyl]phosphonic acid.
| Compound Name | [(9E)-1-[hydroxy(methyl)phosphoryl]-10,14-dimethylpentadeca-9,13-dienyl]phosphonic acid |
|---|---|
| PubChem CID | 10000711 |
| Molecular Formula | C18H36O5P2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | [(9E)-1-[hydroxy(methyl)phosphoryl]-10,14-dimethylpentadeca-9,13-dienyl]phosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CCCCCCCC(P(C)(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C18H36O5P2/c1-16(2)12-11-14-17(3)13-9-7-5-6-8-10-15-18(24(4,19)20)25(21,22)23/h12-13,18H,5-11,14-15H2,1-4H3,(H,19,20)(H2,21,22,23)/b17-13+ |
| InChIKey | IJSHDRSBRXSFIG-GHRIWEEISA-N |
| XLogP | 5.81 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|