C13H25O5P2+ — CID 10087599
[(5E)-6,10-dimethyl-1-phosphonoundeca-5,9-dienyl]-hydroxy-oxophosphanium (PubChem CID 10087599) has the molecular formula C13H25O5P2+ and a molecular weight of 323.29 g/mol. Its IUPAC name is [(5E)-6,10-dimethyl-1-phosphonoundeca-5,9-dienyl]-hydroxy-oxophosphanium.
| Compound Name | [(5E)-6,10-dimethyl-1-phosphonoundeca-5,9-dienyl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 10087599 |
| Molecular Formula | C13H25O5P2+ |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | [(5E)-6,10-dimethyl-1-phosphonoundeca-5,9-dienyl]-hydroxy-oxophosphanium |
| SMILES | CC(C)=CCC/C(C)=C/CCCC([P+](=O)O)P(=O)(O)O |
| InChI | InChI=1S/C13H24O5P2/c1-11(2)7-6-9-12(3)8-4-5-10-13(19(14)15)20(16,17)18/h7-8,13H,4-6,9-10H2,1-3H3,(H2-,14,15,16,17,18)/p+1/b12-8+ |
| InChIKey | RFZXHEWLORMBEF-XYOKQWHBSA-O |
| XLogP | 4.09 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|