C11H18ClO2P — CID 144582180
(4-chlorocyclohexa-1,3-dien-1-yl)methyl-diethoxyphosphane (PubChem CID 144582180) has the molecular formula C11H18ClO2P and a molecular weight of 248.69 g/mol. Its IUPAC name is (4-chlorocyclohexa-1,3-dien-1-yl)methyl-diethoxyphosphane.
| Compound Name | (4-chlorocyclohexa-1,3-dien-1-yl)methyl-diethoxyphosphane |
|---|---|
| PubChem CID | 144582180 |
| Molecular Formula | C11H18ClO2P |
| Molecular Weight | 248.69 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (4-chlorocyclohexa-1,3-dien-1-yl)methyl-diethoxyphosphane |
| SMILES | CCOP(CC1=CC=C(Cl)CC1)OCC |
| InChI | InChI=1S/C11H18ClO2P/c1-3-13-15(14-4-2)9-10-5-7-11(12)8-6-10/h5,7H,3-4,6,8-9H2,1-2H3 |
| InChIKey | LYTNAKZGAGZIHD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.69 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|