About 3-nitrobenzamide
3-nitrobenzamide (PubChem CID 12576) has the molecular formula C7H6N2O3
and a molecular weight of 166.14 g/mol. Its IUPAC name is 3-nitrobenzamide.
Molecular Properties
| Compound Name | 3-nitrobenzamide |
| PubChem CID | 12576 |
| Molecular Formula | C7H6N2O3 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | 3-nitrobenzamide |
| SMILES | NC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H6N2O3/c8-7(10)5-2-1-3-6(4-5)9(11)12/h1-4H,(H2,8,10) |
| InChIKey | KWAYEPXDGHYGRW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrobenzamide?
The IUPAC name of 3-nitrobenzamide (CID 12576) is 3-nitrobenzamide.
What is the SMILES notation for 3-nitrobenzamide?
The canonical SMILES for 3-nitrobenzamide is NC(=O)c1cccc([N+](=O)[O-])c1.
What is the InChIKey of 3-nitrobenzamide?
The InChIKey is KWAYEPXDGHYGRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O3/c8-7(10)5-2-1-3-6(4-5)9(11)12/h1-4H,(H2,8,10).
What are the key properties of 3-nitrobenzamide?
3-nitrobenzamide has a molecular weight of 166.14 g/mol, XLogP of 0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrobenzamide is sourced from PubChem (CID 12576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).