About 2-nitrobenzohydrazide
2-nitrobenzohydrazide (PubChem CID 3781218) has the molecular formula C7H7N3O3
and a molecular weight of 181.15 g/mol. Its IUPAC name is 2-nitrobenzohydrazide.
Molecular Properties
| Compound Name | 2-nitrobenzohydrazide |
| PubChem CID | 3781218 |
| Molecular Formula | C7H7N3O3 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 2-nitrobenzohydrazide |
| SMILES | NNC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7N3O3/c8-9-7(11)5-3-1-2-4-6(5)10(12)13/h1-4H,8H2,(H,9,11) |
| InChIKey | LYGGDXLOJMNFBV-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrobenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrobenzohydrazide?
The IUPAC name of 2-nitrobenzohydrazide (CID 3781218) is 2-nitrobenzohydrazide.
What is the SMILES notation for 2-nitrobenzohydrazide?
The canonical SMILES for 2-nitrobenzohydrazide is NNC(=O)c1ccccc1[N+](=O)[O-].
What is the InChIKey of 2-nitrobenzohydrazide?
The InChIKey is LYGGDXLOJMNFBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O3/c8-9-7(11)5-3-1-2-4-6(5)10(12)13/h1-4H,8H2,(H,9,11).
What are the key properties of 2-nitrobenzohydrazide?
2-nitrobenzohydrazide has a molecular weight of 181.15 g/mol, XLogP of 0.20, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrobenzohydrazide is sourced from PubChem (CID 3781218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).