C14H14F3N3O2 — CID 3464469
2-amino-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]benzohydrazide (PubChem CID 3464469) has the molecular formula C14H14F3N3O2 and a molecular weight of 313.28 g/mol. Its IUPAC name is 2-amino-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]benzohydrazide.
| Compound Name | 2-amino-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]benzohydrazide |
|---|---|
| PubChem CID | 3464469 |
| Molecular Formula | C14H14F3N3O2 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-amino-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]benzohydrazide |
| SMILES | Nc1ccccc1C(=O)NNC1=C(C(=O)C(F)(F)F)CCC1 |
| InChI | InChI=1S/C14H14F3N3O2/c15-14(16,17)12(21)9-5-3-7-11(9)19-20-13(22)8-4-1-2-6-10(8)18/h1-2,4,6,19H,3,5,7,18H2,(H,20,22) |
| InChIKey | QLOQYEFZVNOYEP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|