C8H6N2O2 — CID 2726774
1,2-dihydrocinnoline-3,4-dione (PubChem CID 2726774) has the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. Its IUPAC name is 1,2-dihydrocinnoline-3,4-dione.
| Compound Name | 1,2-dihydrocinnoline-3,4-dione |
|---|---|
| PubChem CID | 2726774 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 1,2-dihydrocinnoline-3,4-dione |
| SMILES | O=c1[nH][nH]c2ccccc2c1=O |
| InChI | InChI=1S/C8H6N2O2/c11-7-5-3-1-2-4-6(5)9-10-8(7)12/h1-4H,(H,9,11)(H,10,12) |
| InChIKey | XYYSYQXZORUJPN-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|