C8H6N3NaO2 — CID 15480750
sodium 8-amino-2H-phthalazin-3-ide-1,4-dione (PubChem CID 15480750) has the molecular formula C8H6N3NaO2 and a molecular weight of 199.15 g/mol. Its IUPAC name is sodium 8-amino-2H-phthalazin-3-ide-1,4-dione.
| Compound Name | sodium 8-amino-2H-phthalazin-3-ide-1,4-dione |
|---|---|
| PubChem CID | 15480750 |
| Molecular Formula | C8H6N3NaO2 |
| Molecular Weight | 199.15 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | sodium 8-amino-2H-phthalazin-3-ide-1,4-dione |
| SMILES | Nc1cccc2c(=O)[n-][nH]c(=O)c12.[Na+] |
| InChI | InChI=1S/C8H7N3O2.Na/c9-5-3-1-2-4-6(5)8(13)11-10-7(4)12;/h1-3H,(H4,9,10,11,12,13);/q;+1/p-1 |
| InChIKey | RVJVDCVIJCBUTH-UHFFFAOYSA-M |
| XLogP | -3.57 |
| TPSA | 90.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.15 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|