C8H7N3O2 — CID 10638
5-amino-2,3-dihydrophthalazine-1,4-dione (PubChem CID 10638) has the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. Its IUPAC name is 5-amino-2,3-dihydrophthalazine-1,4-dione.
| Compound Name | 5-amino-2,3-dihydrophthalazine-1,4-dione |
|---|---|
| PubChem CID | 10638 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 5-amino-2,3-dihydrophthalazine-1,4-dione |
| SMILES | Nc1cccc2c(=O)[nH][nH]c(=O)c12 |
| InChI | InChI=1S/C8H7N3O2/c9-5-3-1-2-4-6(5)8(13)11-10-7(4)12/h1-3H,9H2,(H,10,12)(H,11,13) |
| InChIKey | HWYHZTIRURJOHG-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|