About 2-amino-N'-benzoylbenzohydrazide
2-amino-N'-benzoylbenzohydrazide (PubChem CID 4550515) has the molecular formula C14H13N3O2
and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-amino-N'-benzoylbenzohydrazide.
Molecular Properties
| Compound Name | 2-amino-N'-benzoylbenzohydrazide |
| PubChem CID | 4550515 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-amino-N'-benzoylbenzohydrazide |
| SMILES | Nc1ccccc1C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H13N3O2/c15-12-9-5-4-8-11(12)14(19)17-16-13(18)10-6-2-1-3-7-10/h1-9H,15H2,(H,16,18)(H,17,19) |
| InChIKey | PRFZPINUJVSKGJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N'-benzoylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N'-benzoylbenzohydrazide?
The IUPAC name of 2-amino-N'-benzoylbenzohydrazide (CID 4550515) is 2-amino-N'-benzoylbenzohydrazide.
What is the SMILES notation for 2-amino-N'-benzoylbenzohydrazide?
The canonical SMILES for 2-amino-N'-benzoylbenzohydrazide is Nc1ccccc1C(=O)NNC(=O)c1ccccc1.
What is the InChIKey of 2-amino-N'-benzoylbenzohydrazide?
The InChIKey is PRFZPINUJVSKGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2/c15-12-9-5-4-8-11(12)14(19)17-16-13(18)10-6-2-1-3-7-10/h1-9H,15H2,(H,16,18)(H,17,19).
What are the key properties of 2-amino-N'-benzoylbenzohydrazide?
2-amino-N'-benzoylbenzohydrazide has a molecular weight of 255.28 g/mol, XLogP of 1.34, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N'-benzoylbenzohydrazide is sourced from PubChem (CID 4550515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).