C27H21N3O4 — CID 12579892
5-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-phenyl-3a,4,5,9b-tetrahydropyrrolo[3,4-f]quinoline-1,3-dione (PubChem CID 12579892) has the molecular formula C27H21N3O4 and a molecular weight of 451.48 g/mol. Its IUPAC name is 5-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-phenyl-3a,4,5,9b-tetrahydropyrrolo[3,4-f]quinoline-1,3-dione.
| Compound Name | 5-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-phenyl-3a,4,5,9b-tetrahydropyrrolo[3,4-f]quinoline-1,3-dione |
|---|---|
| PubChem CID | 12579892 |
| Molecular Formula | C27H21N3O4 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 5-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-phenyl-3a,4,5,9b-tetrahydropyrrolo[3,4-f]quinoline-1,3-dione |
| SMILES | O=C1CC(C2CC3C(=O)N(c4ccccc4)C(=O)C3c3cccnc32)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C27H21N3O4/c31-22-15-20(25(32)29(22)16-8-3-1-4-9-16)19-14-21-23(18-12-7-13-28-24(18)19)27(34)30(26(21)33)17-10-5-2-6-11-17/h1-13,19-21,23H,14-15H2 |
| InChIKey | UWRWFLPYHXYOTJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|