About 4-phenyl-3,6-dihydro-2H-oxazine
4-phenyl-3,6-dihydro-2H-oxazine (PubChem CID 12580583) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 4-phenyl-3,6-dihydro-2H-oxazine.
Molecular Properties
| Compound Name | 4-phenyl-3,6-dihydro-2H-oxazine |
| PubChem CID | 12580583 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 4-phenyl-3,6-dihydro-2H-oxazine |
| SMILES | C1=C(c2ccccc2)CNOC1 |
| InChI | InChI=1S/C10H11NO/c1-2-4-9(5-3-1)10-6-7-12-11-8-10/h1-6,11H,7-8H2 |
| InChIKey | FSIXMONWRDBBTE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenyl-3,6-dihydro-2H-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-3,6-dihydro-2H-oxazine?
The IUPAC name of 4-phenyl-3,6-dihydro-2H-oxazine (CID 12580583) is 4-phenyl-3,6-dihydro-2H-oxazine.
What is the SMILES notation for 4-phenyl-3,6-dihydro-2H-oxazine?
The canonical SMILES for 4-phenyl-3,6-dihydro-2H-oxazine is C1=C(c2ccccc2)CNOC1.
What is the InChIKey of 4-phenyl-3,6-dihydro-2H-oxazine?
The InChIKey is FSIXMONWRDBBTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c1-2-4-9(5-3-1)10-6-7-12-11-8-10/h1-6,11H,7-8H2.
What are the key properties of 4-phenyl-3,6-dihydro-2H-oxazine?
4-phenyl-3,6-dihydro-2H-oxazine has a molecular weight of 161.20 g/mol, XLogP of 1.60, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-3,6-dihydro-2H-oxazine is sourced from PubChem (CID 12580583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).