About 5-ethyl-1-methyl-4-phenylsulfanyl-3,4-dihydro-2H-pyridine
5-ethyl-1-methyl-4-phenylsulfanyl-3,4-dihydro-2H-pyridine (PubChem CID 12581461) has the molecular formula C14H19NS
and a molecular weight of 233.38 g/mol. Its IUPAC name is 5-ethyl-1-methyl-4-phenylsulfanyl-3,4-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 5-ethyl-1-methyl-4-phenylsulfanyl-3,4-dihydro-2H-pyridine |
| PubChem CID | 12581461 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 5-ethyl-1-methyl-4-phenylsulfanyl-3,4-dihydro-2H-pyridine |
| SMILES | CCC1=CN(C)CCC1Sc1ccccc1 |
| InChI | InChI=1S/C14H19NS/c1-3-12-11-15(2)10-9-14(12)16-13-7-5-4-6-8-13/h4-8,11,14H,3,9-10H2,1-2H3 |
| InChIKey | NJTQSYJQLOIVFF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-1-methyl-4-phenylsulfanyl-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1-methyl-4-phenylsulfanyl-3,4-dihydro-2H-pyridine?
The IUPAC name of 5-ethyl-1-methyl-4-phenylsulfanyl-3,4-dihydro-2H-pyridine (CID 12581461) is 5-ethyl-1-methyl-4-phenylsulfanyl-3,4-dihydro-2H-pyridine.
What is the SMILES notation for 5-ethyl-1-methyl-4-phenylsulfanyl-3,4-dihydro-2H-pyridine?
The canonical SMILES for 5-ethyl-1-methyl-4-phenylsulfanyl-3,4-dihydro-2H-pyridine is CCC1=CN(C)CCC1Sc1ccccc1.
What is the InChIKey of 5-ethyl-1-methyl-4-phenylsulfanyl-3,4-dihydro-2H-pyridine?
The InChIKey is NJTQSYJQLOIVFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NS/c1-3-12-11-15(2)10-9-14(12)16-13-7-5-4-6-8-13/h4-8,11,14H,3,9-10H2,1-2H3.
What are the key properties of 5-ethyl-1-methyl-4-phenylsulfanyl-3,4-dihydro-2H-pyridine?
5-ethyl-1-methyl-4-phenylsulfanyl-3,4-dihydro-2H-pyridine has a molecular weight of 233.38 g/mol, XLogP of 3.78, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1-methyl-4-phenylsulfanyl-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 12581461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).