C24H22O5S — CID 12587250
ethyl 3-(benzenesulfonyl)-2-oxo-4,4-diphenylbutanoate (PubChem CID 12587250) has the molecular formula C24H22O5S and a molecular weight of 422.50 g/mol. Its IUPAC name is ethyl 3-(benzenesulfonyl)-2-oxo-4,4-diphenylbutanoate.
| Compound Name | ethyl 3-(benzenesulfonyl)-2-oxo-4,4-diphenylbutanoate |
|---|---|
| PubChem CID | 12587250 |
| Molecular Formula | C24H22O5S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | ethyl 3-(benzenesulfonyl)-2-oxo-4,4-diphenylbutanoate |
| SMILES | CCOC(=O)C(=O)C(C(c1ccccc1)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H22O5S/c1-2-29-24(26)22(25)23(30(27,28)20-16-10-5-11-17-20)21(18-12-6-3-7-13-18)19-14-8-4-9-15-19/h3-17,21,23H,2H2,1H3 |
| InChIKey | MXMMOYDDYLYFTK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|