C21H25NOS2 — CID 12590230
4-[3,3-bis(methylsulfanyl)-1,2-diphenylprop-2-enyl]morpholine (PubChem CID 12590230) has the molecular formula C21H25NOS2 and a molecular weight of 371.57 g/mol. Its IUPAC name is 4-[3,3-bis(methylsulfanyl)-1,2-diphenylprop-2-enyl]morpholine.
| Compound Name | 4-[3,3-bis(methylsulfanyl)-1,2-diphenylprop-2-enyl]morpholine |
|---|---|
| PubChem CID | 12590230 |
| Molecular Formula | C21H25NOS2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 4-[3,3-bis(methylsulfanyl)-1,2-diphenylprop-2-enyl]morpholine |
| SMILES | CSC(SC)=C(c1ccccc1)C(c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C21H25NOS2/c1-24-21(25-2)19(17-9-5-3-6-10-17)20(18-11-7-4-8-12-18)22-13-15-23-16-14-22/h3-12,20H,13-16H2,1-2H3 |
| InChIKey | QIAKUSYTEPPHCO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |