C26H23ClF2N4O5S — CID 1259083
N-[4-[chloro(difluoro)methoxy]phenyl]-2-[4-[3-(dimethylsulfamoyl)-4-methylphenyl]-1-oxophthalazin-2-yl]acetamide (PubChem CID 1259083) has the molecular formula C26H23ClF2N4O5S and a molecular weight of 577.01 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-2-[4-[3-(dimethylsulfamoyl)-4-methylphenyl]-1-oxophthalazin-2-yl]acetamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-2-[4-[3-(dimethylsulfamoyl)-4-methylphenyl]-1-oxophthalazin-2-yl]acetamide |
|---|---|
| PubChem CID | 1259083 |
| Molecular Formula | C26H23ClF2N4O5S |
| Molecular Weight | 577.01 g/mol |
| Exact Mass | 576.10 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-2-[4-[3-(dimethylsulfamoyl)-4-methylphenyl]-1-oxophthalazin-2-yl]acetamide |
| SMILES | Cc1ccc(-c2nn(CC(=O)Nc3ccc(OC(F)(F)Cl)cc3)c(=O)c3ccccc23)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C26H23ClF2N4O5S/c1-16-8-9-17(14-22(16)39(36,37)32(2)3)24-20-6-4-5-7-21(20)25(35)33(31-24)15-23(34)30-18-10-12-19(13-11-18)38-26(27,28)29/h4-14H,15H2,1-3H3,(H,30,34) |
| InChIKey | UPXNTWGCTYFYEC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.01 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|