C19H22N6O3S — CID 4845449
N-[3-(dimethylsulfamoyl)-4-methylphenyl]-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide (PubChem CID 4845449) has the molecular formula C19H22N6O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)-4-methylphenyl]-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide.
| Compound Name | N-[3-(dimethylsulfamoyl)-4-methylphenyl]-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 4845449 |
| Molecular Formula | C19H22N6O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)-4-methylphenyl]-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide |
| SMILES | Cc1ccccc1-c1nnn(CC(=O)Nc2ccc(C)c(S(=O)(=O)N(C)C)c2)n1 |
| InChI | InChI=1S/C19H22N6O3S/c1-13-7-5-6-8-16(13)19-21-23-25(22-19)12-18(26)20-15-10-9-14(2)17(11-15)29(27,28)24(3)4/h5-11H,12H2,1-4H3,(H,20,26) |
| InChIKey | ASMAPKZOECJDJT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |