C18H22N4O2P2 — CID 12592282
1,3,6,8-tetramethyl-4,5-diphenyl-1,3,6,8-tetraza-4λ5,5-diphosphaspiro[3.4]octane-2,7-dione (PubChem CID 12592282) has the molecular formula C18H22N4O2P2 and a molecular weight of 388.35 g/mol. Its IUPAC name is 1,3,6,8-tetramethyl-4,5-diphenyl-1,3,6,8-tetraza-4λ5,5-diphosphaspiro[3.4]octane-2,7-dione.
| Compound Name | 1,3,6,8-tetramethyl-4,5-diphenyl-1,3,6,8-tetraza-4λ5,5-diphosphaspiro[3.4]octane-2,7-dione |
|---|---|
| PubChem CID | 12592282 |
| Molecular Formula | C18H22N4O2P2 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1,3,6,8-tetramethyl-4,5-diphenyl-1,3,6,8-tetraza-4λ5,5-diphosphaspiro[3.4]octane-2,7-dione |
| SMILES | CN1C(=O)N(C)P2(c3ccccc3)(N(C)C(=O)N2C)P1c1ccccc1 |
| InChI | InChI=1S/C18H22N4O2P2/c1-19-17(23)20(2)26(16-13-9-6-10-14-16,21(3)18(24)22(26)4)25(19)15-11-7-5-8-12-15/h5-14H,1-4H3 |
| InChIKey | FKPUDDZLSBSFBD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|