C24H27N5O2P2 — CID 23416823
1,3,5,7-tetramethyl-4-[(triphenyl-λ5-phosphanylidene)amino]-1,3,5,7-tetraza-4λ5-phosphaspiro[3.3]heptane-2,6-dione (PubChem CID 23416823) has the molecular formula C24H27N5O2P2 and a molecular weight of 479.46 g/mol. Its IUPAC name is 1,3,5,7-tetramethyl-4-[(triphenyl-λ5-phosphanylidene)amino]-1,3,5,7-tetraza-4λ5-phosphaspiro[3.3]heptane-2,6-dione.
| Compound Name | 1,3,5,7-tetramethyl-4-[(triphenyl-λ5-phosphanylidene)amino]-1,3,5,7-tetraza-4λ5-phosphaspiro[3.3]heptane-2,6-dione |
|---|---|
| PubChem CID | 23416823 |
| Molecular Formula | C24H27N5O2P2 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 1,3,5,7-tetramethyl-4-[(triphenyl-λ5-phosphanylidene)amino]-1,3,5,7-tetraza-4λ5-phosphaspiro[3.3]heptane-2,6-dione |
| SMILES | CN1C(=O)N(C)P12(N=P(c1ccccc1)(c1ccccc1)c1ccccc1)N(C)C(=O)N2C |
| InChI | InChI=1S/C24H27N5O2P2/c1-26-23(30)27(2)33(26,28(3)24(31)29(33)4)25-32(20-14-8-5-9-15-20,21-16-10-6-11-17-21)22-18-12-7-13-19-22/h5-19H,1-4H3 |
| InChIKey | WKGJBFVJSQYWGJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 59.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|