C27H26N5OP3 — CID 23419347
1,3-dimethyl-6,6,8,8-tetraphenyl-1,3,5,7,9-pentaza-4λ5,6λ5,8λ5-triphosphaspiro[3.5]nona-4,6,8-trien-2-one (PubChem CID 23419347) has the molecular formula C27H26N5OP3 and a molecular weight of 529.46 g/mol. Its IUPAC name is 1,3-dimethyl-6,6,8,8-tetraphenyl-1,3,5,7,9-pentaza-4λ5,6λ5,8λ5-triphosphaspiro[3.5]nona-4,6,8-trien-2-one.
| Compound Name | 1,3-dimethyl-6,6,8,8-tetraphenyl-1,3,5,7,9-pentaza-4λ5,6λ5,8λ5-triphosphaspiro[3.5]nona-4,6,8-trien-2-one |
|---|---|
| PubChem CID | 23419347 |
| Molecular Formula | C27H26N5OP3 |
| Molecular Weight | 529.46 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 1,3-dimethyl-6,6,8,8-tetraphenyl-1,3,5,7,9-pentaza-4λ5,6λ5,8λ5-triphosphaspiro[3.5]nona-4,6,8-trien-2-one |
| SMILES | CN1C(=O)N(C)P12=NP(c1ccccc1)(c1ccccc1)=NP(c1ccccc1)(c1ccccc1)=N2 |
| InChI | InChI=1S/C27H26N5OP3/c1-31-27(33)32(2)36(31)29-34(23-15-7-3-8-16-23,24-17-9-4-10-18-24)28-35(30-36,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22H,1-2H3 |
| InChIKey | MGDKJNAUTYMNJK-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 60.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.46 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|