C29H30N2OP2 — CID 15497180
1,3-bis(diphenylphosphanyl)-1,3-diethylurea (PubChem CID 15497180) has the molecular formula C29H30N2OP2 and a molecular weight of 484.52 g/mol. Its IUPAC name is 1,3-bis(diphenylphosphanyl)-1,3-diethylurea.
| Compound Name | 1,3-bis(diphenylphosphanyl)-1,3-diethylurea |
|---|---|
| PubChem CID | 15497180 |
| Molecular Formula | C29H30N2OP2 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 1,3-bis(diphenylphosphanyl)-1,3-diethylurea |
| SMILES | CCN(C(=O)N(CC)P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H30N2OP2/c1-3-30(33(25-17-9-5-10-18-25)26-19-11-6-12-20-26)29(32)31(4-2)34(27-21-13-7-14-22-27)28-23-15-8-16-24-28/h5-24H,3-4H2,1-2H3 |
| InChIKey | BXYDUAVMWCBZEL-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|