C28H32N5P3 — CID 23419240
2-N,2-N,2-N',2-N'-tetramethyl-4,4,6,6-tetraphenyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,2-diamine (PubChem CID 23419240) has the molecular formula C28H32N5P3 and a molecular weight of 531.52 g/mol. Its IUPAC name is 2-N,2-N,2-N',2-N'-tetramethyl-4,4,6,6-tetraphenyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,2-diamine.
| Compound Name | 2-N,2-N,2-N',2-N'-tetramethyl-4,4,6,6-tetraphenyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,2-diamine |
|---|---|
| PubChem CID | 23419240 |
| Molecular Formula | C28H32N5P3 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 2-N,2-N,2-N',2-N'-tetramethyl-4,4,6,6-tetraphenyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,2-diamine |
| SMILES | CN(C)P1(N(C)C)=NP(c2ccccc2)(c2ccccc2)=NP(c2ccccc2)(c2ccccc2)=N1 |
| InChI | InChI=1S/C28H32N5P3/c1-32(2)36(33(3)4)30-34(25-17-9-5-10-18-25,26-19-11-6-12-20-26)29-35(31-36,27-21-13-7-14-22-27)28-23-15-8-16-24-28/h5-24H,1-4H3 |
| InChIKey | TWRRAVXJAKGWES-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 43.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|