C40H34N2O2P2+2 — CID 3090773
[2,4-dioxo-3-(triphenylphosphaniumylmethyl)-1,3-diazetidin-1-yl]methyl-triphenylphosphanium (PubChem CID 3090773) has the molecular formula C40H34N2O2P2+2 and a molecular weight of 636.67 g/mol. Its IUPAC name is [2,4-dioxo-3-(triphenylphosphaniumylmethyl)-1,3-diazetidin-1-yl]methyl-triphenylphosphanium.
| Compound Name | [2,4-dioxo-3-(triphenylphosphaniumylmethyl)-1,3-diazetidin-1-yl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 3090773 |
| Molecular Formula | C40H34N2O2P2+2 |
| Molecular Weight | 636.67 g/mol |
| Exact Mass | 636.21 |
| IUPAC Name | [2,4-dioxo-3-(triphenylphosphaniumylmethyl)-1,3-diazetidin-1-yl]methyl-triphenylphosphanium |
| SMILES | O=C1N(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)N1C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H34N2O2P2/c43-39-41(31-45(33-19-7-1-8-20-33,34-21-9-2-10-22-34)35-23-11-3-12-24-35)40(44)42(39)32-46(36-25-13-4-14-26-36,37-27-15-5-16-28-37)38-29-17-6-18-30-38/h1-30H,31-32H2/q+2 |
| InChIKey | BIIXBDXRPVRADN-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.67 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|