C21H21N2OP — CID 23417824
1,1-dimethyl-3-(triphenyl-λ5-phosphanylidene)urea (PubChem CID 23417824) has the molecular formula C21H21N2OP and a molecular weight of 348.39 g/mol. Its IUPAC name is 1,1-dimethyl-3-(triphenyl-λ5-phosphanylidene)urea.
| Compound Name | 1,1-dimethyl-3-(triphenyl-λ5-phosphanylidene)urea |
|---|---|
| PubChem CID | 23417824 |
| Molecular Formula | C21H21N2OP |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1,1-dimethyl-3-(triphenyl-λ5-phosphanylidene)urea |
| SMILES | CN(C)C(=O)N=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21N2OP/c1-23(2)21(24)22-25(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h3-17H,1-2H3 |
| InChIKey | LUWLVUOCJJBKLU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|