C27H29N4P3 — CID 23419244
N,N,2-trimethyl-4,4,6,6-tetraphenyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-amine (PubChem CID 23419244) has the molecular formula C27H29N4P3 and a molecular weight of 502.48 g/mol. Its IUPAC name is N,N,2-trimethyl-4,4,6,6-tetraphenyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-amine.
| Compound Name | N,N,2-trimethyl-4,4,6,6-tetraphenyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 23419244 |
| Molecular Formula | C27H29N4P3 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | N,N,2-trimethyl-4,4,6,6-tetraphenyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-amine |
| SMILES | CN(C)P1(C)=NP(c2ccccc2)(c2ccccc2)=NP(c2ccccc2)(c2ccccc2)=N1 |
| InChI | InChI=1S/C27H29N4P3/c1-31(2)32(3)28-33(24-16-8-4-9-17-24,25-18-10-5-11-19-25)30-34(29-32,26-20-12-6-13-21-26)27-22-14-7-15-23-27/h4-23H,1-3H3 |
| InChIKey | UAASIQFKHCYZGF-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|