C26H26N4P3+ — CID 23419241
N,N-dimethyl-4,4,6,6-tetraphenyl-1,3,5-triaza-4λ5,6λ5-diphospha-2-phosphoniacyclohexa-1,3,5-trien-2-amine (PubChem CID 23419241) has the molecular formula C26H26N4P3+ and a molecular weight of 487.44 g/mol. Its IUPAC name is N,N-dimethyl-4,4,6,6-tetraphenyl-1,3,5-triaza-4λ5,6λ5-diphospha-2-phosphoniacyclohexa-1,3,5-trien-2-amine.
| Compound Name | N,N-dimethyl-4,4,6,6-tetraphenyl-1,3,5-triaza-4λ5,6λ5-diphospha-2-phosphoniacyclohexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 23419241 |
| Molecular Formula | C26H26N4P3+ |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | N,N-dimethyl-4,4,6,6-tetraphenyl-1,3,5-triaza-4λ5,6λ5-diphospha-2-phosphoniacyclohexa-1,3,5-trien-2-amine |
| SMILES | CN(C)[P+]1=NP(c2ccccc2)(c2ccccc2)=NP(c2ccccc2)(c2ccccc2)=N1 |
| InChI | InChI=1S/C26H26N4P3/c1-30(2)31-27-32(23-15-7-3-8-16-23,24-17-9-4-10-18-24)29-33(28-31,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22H,1-2H3/q+1 |
| InChIKey | JZXDXWODFKWJHV-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|