C20H26Cl2N3O5P3 — CID 139063722
(1S,15S)-1,15-dichloro-17,17-diphenyl-2,5,8,11,14-pentaoxa-16,18,19-triaza-1λ5,15λ5,17λ5-triphosphabicyclo[13.3.1]nonadeca-1(19),15,17-triene (PubChem CID 139063722) has the molecular formula C20H26Cl2N3O5P3 and a molecular weight of 552.27 g/mol. Its IUPAC name is (1S,15S)-1,15-dichloro-17,17-diphenyl-2,5,8,11,14-pentaoxa-16,18,19-triaza-1λ5,15λ5,17λ5-triphosphabicyclo[13.3.1]nonadeca-1(19),15,17-triene.
| Compound Name | (1S,15S)-1,15-dichloro-17,17-diphenyl-2,5,8,11,14-pentaoxa-16,18,19-triaza-1λ5,15λ5,17λ5-triphosphabicyclo[13.3.1]nonadeca-1(19),15,17-triene |
|---|---|
| PubChem CID | 139063722 |
| Molecular Formula | C20H26Cl2N3O5P3 |
| Molecular Weight | 552.27 g/mol |
| Exact Mass | 551.05 |
| IUPAC Name | (1S,15S)-1,15-dichloro-17,17-diphenyl-2,5,8,11,14-pentaoxa-16,18,19-triaza-1λ5,15λ5,17λ5-triphosphabicyclo[13.3.1]nonadeca-1(19),15,17-triene |
| SMILES | Cl[P@@]12=N[P@@](Cl)(=NP(c3ccccc3)(c3ccccc3)=N1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C20H26Cl2N3O5P3/c21-32-23-31(19-7-3-1-4-8-19,20-9-5-2-6-10-20)24-33(22,25-32)30-18-16-28-14-12-26-11-13-27-15-17-29-32/h1-10H,11-18H2/t32-,33+ |
| InChIKey | XQIJEHFUAPKXPF-CZFRINIUSA-N |
| XLogP | 6.23 |
| TPSA | 83.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.27 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|