C18H15F3N3P3 — CID 23417905
2,2,4-trifluoro-4,6,6-triphenyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene (PubChem CID 23417905) has the molecular formula C18H15F3N3P3 and a molecular weight of 423.26 g/mol. Its IUPAC name is 2,2,4-trifluoro-4,6,6-triphenyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene.
| Compound Name | 2,2,4-trifluoro-4,6,6-triphenyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 23417905 |
| Molecular Formula | C18H15F3N3P3 |
| Molecular Weight | 423.26 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | 2,2,4-trifluoro-4,6,6-triphenyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
| SMILES | FP1(F)=NP(c2ccccc2)(c2ccccc2)=NP(F)(c2ccccc2)=N1 |
| InChI | InChI=1S/C18H15F3N3P3/c19-26(18-14-8-3-9-15-18)22-25(23-27(20,21)24-26,16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-15H |
| InChIKey | BQFCXIDBKXVQRJ-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.26 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|