C19H14ClN2P — CID 134869959
5-chloro-3,3-diphenyl-2,4-diaza-3λ5-phosphabicyclo[4.4.0]deca-1(10),2,4,6,8-pentaene (PubChem CID 134869959) has the molecular formula C19H14ClN2P and a molecular weight of 336.76 g/mol. Its IUPAC name is 5-chloro-3,3-diphenyl-2,4-diaza-3λ5-phosphabicyclo[4.4.0]deca-1(10),2,4,6,8-pentaene.
| Compound Name | 5-chloro-3,3-diphenyl-2,4-diaza-3λ5-phosphabicyclo[4.4.0]deca-1(10),2,4,6,8-pentaene |
|---|---|
| PubChem CID | 134869959 |
| Molecular Formula | C19H14ClN2P |
| Molecular Weight | 336.76 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 5-chloro-3,3-diphenyl-2,4-diaza-3λ5-phosphabicyclo[4.4.0]deca-1(10),2,4,6,8-pentaene |
| SMILES | ClC1=NP(c2ccccc2)(c2ccccc2)=Nc2ccccc21 |
| InChI | InChI=1S/C19H14ClN2P/c20-19-17-13-7-8-14-18(17)21-23(22-19,15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H |
| InChIKey | LMIBCHUXLCWOEW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.76 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|