C29H28Cl4N6O4P6 — CID 102178732
4,4,16,16-tetrachloro-2,2,14,14-tetraphenyl-7,11,18,21-tetraoxa-1,3,5,13,15,17-hexaza-2λ5,4λ5,6λ5,12λ5,14λ5,16λ5-hexaphosphatrispiro[5.2.2.512.29.26]henicosa-1,3,5,12(17),13,15-hexaene (PubChem CID 102178732) has the molecular formula C29H28Cl4N6O4P6 and a molecular weight of 852.24 g/mol. Its IUPAC name is 4,4,16,16-tetrachloro-2,2,14,14-tetraphenyl-7,11,18,21-tetraoxa-1,3,5,13,15,17-hexaza-2λ5,4λ5,6λ5,12λ5,14λ5,16λ5-hexaphosphatrispiro[5.2.2.512.29.26]henicosa-1,3,5,12(17),13,15-hexaene.
| Compound Name | 4,4,16,16-tetrachloro-2,2,14,14-tetraphenyl-7,11,18,21-tetraoxa-1,3,5,13,15,17-hexaza-2λ5,4λ5,6λ5,12λ5,14λ5,16λ5-hexaphosphatrispiro[5.2.2.512.29.26]henicosa-1,3,5,12(17),13,15-hexaene |
|---|---|
| PubChem CID | 102178732 |
| Molecular Formula | C29H28Cl4N6O4P6 |
| Molecular Weight | 852.24 g/mol |
| Exact Mass | 849.94 |
| IUPAC Name | 4,4,16,16-tetrachloro-2,2,14,14-tetraphenyl-7,11,18,21-tetraoxa-1,3,5,13,15,17-hexaza-2λ5,4λ5,6λ5,12λ5,14λ5,16λ5-hexaphosphatrispiro[5.2.2.512.29.26]henicosa-1,3,5,12(17),13,15-hexaene |
| SMILES | ClP1(Cl)=NP(c2ccccc2)(c2ccccc2)=NP2(=N1)OCC1(CO2)COP2(=NP(Cl)(Cl)=NP(c3ccccc3)(c3ccccc3)=N2)OC1 |
| InChI | InChI=1S/C29H28Cl4N6O4P6/c30-46(31)34-44(25-13-5-1-6-14-25,26-15-7-2-8-16-26)36-48(38-46)40-21-29(22-41-48)23-42-49(43-24-29)37-45(35-47(32,33)39-49,27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20H,21-24H2 |
| InChIKey | NUDGELYVPRWMNZ-UHFFFAOYSA-N |
| XLogP | 12.37 |
| TPSA | 111.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.24 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|