C17H18NO7P2- — CID 171069326
(3,9-dioxo-3-phenoxy-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecan-9-yl)-phenylazanide (PubChem CID 171069326) has the molecular formula C17H18NO7P2- and a molecular weight of 410.28 g/mol. Its IUPAC name is (3,9-dioxo-3-phenoxy-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecan-9-yl)-phenylazanide.
| Compound Name | (3,9-dioxo-3-phenoxy-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecan-9-yl)-phenylazanide |
|---|---|
| PubChem CID | 171069326 |
| Molecular Formula | C17H18NO7P2- |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | (3,9-dioxo-3-phenoxy-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecan-9-yl)-phenylazanide |
| SMILES | O=P1([N-]c2ccccc2)OCC2(CO1)COP(=O)(Oc1ccccc1)OC2 |
| InChI | InChI=1S/C17H18NO7P2/c19-26(18-15-7-3-1-4-8-15)21-11-17(12-22-26)13-23-27(20,24-14-17)25-16-9-5-2-6-10-16/h1-10H,11-14H2/q-1 |
| InChIKey | KICFXABTEJZDTD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|