C10H14NO3P — CID 125493267
(2R,4R)-4-methyl-2-phenoxy-1,3,2λ5-oxazaphosphinane 2-oxide (PubChem CID 125493267) has the molecular formula C10H14NO3P and a molecular weight of 227.20 g/mol. Its IUPAC name is (2R,4R)-4-methyl-2-phenoxy-1,3,2λ5-oxazaphosphinane 2-oxide.
| Compound Name | (2R,4R)-4-methyl-2-phenoxy-1,3,2λ5-oxazaphosphinane 2-oxide |
|---|---|
| PubChem CID | 125493267 |
| Molecular Formula | C10H14NO3P |
| Molecular Weight | 227.20 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | (2R,4R)-4-methyl-2-phenoxy-1,3,2λ5-oxazaphosphinane 2-oxide |
| SMILES | C[C@@H]1CCO[P@@](=O)(Oc2ccccc2)N1 |
| InChI | InChI=1S/C10H14NO3P/c1-9-7-8-13-15(12,11-9)14-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,11,12)/t9-,15-/m1/s1 |
| InChIKey | WPDATXOFGXAWDR-RFAUZJTJSA-N |
| XLogP | 2.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.20 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|