C16H16BrO4P — CID 10915953
(2S,4S,5R)-5-bromo-2-phenoxy-4-phenyl-1,3,2λ5-dioxaphosphepane 2-oxide (PubChem CID 10915953) has the molecular formula C16H16BrO4P and a molecular weight of 383.18 g/mol. Its IUPAC name is (2S,4S,5R)-5-bromo-2-phenoxy-4-phenyl-1,3,2λ5-dioxaphosphepane 2-oxide.
| Compound Name | (2S,4S,5R)-5-bromo-2-phenoxy-4-phenyl-1,3,2λ5-dioxaphosphepane 2-oxide |
|---|---|
| PubChem CID | 10915953 |
| Molecular Formula | C16H16BrO4P |
| Molecular Weight | 383.18 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | (2S,4S,5R)-5-bromo-2-phenoxy-4-phenyl-1,3,2λ5-dioxaphosphepane 2-oxide |
| SMILES | O=[P@]1(Oc2ccccc2)OCC[C@@H](Br)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C16H16BrO4P/c17-15-11-12-19-22(18,20-14-9-5-2-6-10-14)21-16(15)13-7-3-1-4-8-13/h1-10,15-16H,11-12H2/t15-,16+,22-/m1/s1 |
| InChIKey | LCNVOWRMEHCBSA-ZMPRRUGASA-N |
| XLogP | 5.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.18 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|